Write the chemical equations involved in the following reactions: (i) Hoffmann-bromamide degradation reaction. (ii) Carbylamine reaction.

(i) Hoffmann-bromamide degradation reaction:When an amide is treated with bromine and aqueous or alcoholic sodium hydroxide, it gives a primary amine.In this reaction, the amine obtained contains one C atom less than amide.Ph−CONH2+Br2+4NaOH→Ph−NH2+Na2CO3+2NaBr+2H2O(ii) Carbylamine reaction:Aliphatic or aromatic primary amines on heating with chloroform and alcoholic potassium hydroxide gives foul smelling alkyl isocyanides or carbylamines. Secondary or tertiary amines do not give this test.Ph−NH2+CHCl3+3KOHΔ→Ph−NC+3KCl+3H2O